C16H20N2O3 — CID 81338545
ethyl (3S)-1-(1,3-benzoxazol-2-ylmethyl)piperidine-3-carboxylate (PubChem CID 81338545) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl (3S)-1-(1,3-benzoxazol-2-ylmethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(1,3-benzoxazol-2-ylmethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81338545 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl (3S)-1-(1,3-benzoxazol-2-ylmethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C16H20N2O3/c1-2-20-16(19)12-6-5-9-18(10-12)11-15-17-13-7-3-4-8-14(13)21-15/h3-4,7-8,12H,2,5-6,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | ZDPSJRPQKPYCAQ-LBPRGKRZSA-N |
| XLogP | 2.60 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |