About 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione
4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione (PubChem CID 81339611) has the molecular formula C9H13F3N2S
and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione |
| PubChem CID | 81339611 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1CC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2S/c1-8(2,3)6-4-13-7(15)14(6)5-9(10,11)12/h4H,5H2,1-3H3,(H,13,15) |
| InChIKey | OSEOEINPUULEHM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The IUPAC name of 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione (CID 81339611) is 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione.
What is the SMILES notation for 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The canonical SMILES for 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione is CC(C)(C)c1c[nH]c(=S)n1CC(F)(F)F.
What is the InChIKey of 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The InChIKey is OSEOEINPUULEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2S/c1-8(2,3)6-4-13-7(15)14(6)5-9(10,11)12/h4H,5H2,1-3H3,(H,13,15).
What are the key properties of 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione has a molecular weight of 238.28 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione is sourced from PubChem (CID 81339611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).