About 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide
1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide (PubChem CID 81339718) has the molecular formula C5H6F3N3O2S
and a molecular weight of 229.18 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
| PubChem CID | 81339718 |
| Molecular Formula | C5H6F3N3O2S |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C5H6F3N3O2S/c6-5(7,8)3-11-2-4(1-10-11)14(9,12)13/h1-2H,3H2,(H2,9,12,13) |
| InChIKey | PVRPNCDZWCAQNK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide?
The IUPAC name of 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide (CID 81339718) is 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide is NS(=O)(=O)c1cnn(CC(F)(F)F)c1.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide?
The InChIKey is PVRPNCDZWCAQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3N3O2S/c6-5(7,8)3-11-2-4(1-10-11)14(9,12)13/h1-2H,3H2,(H2,9,12,13).
What are the key properties of 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide?
1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide has a molecular weight of 229.18 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 81339718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).