C10H14F3N3O4 — CID 81339845
4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)butanamide (PubChem CID 81339845) has the molecular formula C10H14F3N3O4 and a molecular weight of 297.23 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)butanamide |
|---|---|
| PubChem CID | 81339845 |
| Molecular Formula | C10H14F3N3O4 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(2,2,2-trifluoroethoxy)butanamide |
| SMILES | CN1CC(=O)N(CCCC(=O)NOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H14F3N3O4/c1-15-5-8(18)16(9(15)19)4-2-3-7(17)14-20-6-10(11,12)13/h2-6H2,1H3,(H,14,17) |
| InChIKey | MVDDMSXZIFDLIP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|