C10H7ClF3N3O2S — CID 81340429
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide (PubChem CID 81340429) has the molecular formula C10H7ClF3N3O2S and a molecular weight of 325.70 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide |
|---|---|
| PubChem CID | 81340429 |
| Molecular Formula | C10H7ClF3N3O2S |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)nc2sccn12)NOCC(F)(F)F |
| InChI | InChI=1S/C10H7ClF3N3O2S/c11-8-6(17-3-4-20-9(17)15-8)1-2-7(18)16-19-5-10(12,13)14/h1-4H,5H2,(H,16,18)/b2-1+ |
| InChIKey | GDJNBHFGEXJYLF-OWOJBTEDSA-N |
| XLogP | 2.67 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|