C11H8F3N3O3 — CID 81340511
4-oxo-N-(2,2,2-trifluoroethoxy)pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 81340511) has the molecular formula C11H8F3N3O3 and a molecular weight of 287.20 g/mol. Its IUPAC name is 4-oxo-N-(2,2,2-trifluoroethoxy)pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 4-oxo-N-(2,2,2-trifluoroethoxy)pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 81340511 |
| Molecular Formula | C11H8F3N3O3 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-oxo-N-(2,2,2-trifluoroethoxy)pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | O=C(NOCC(F)(F)F)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C11H8F3N3O3/c12-11(13,14)6-20-16-9(18)7-5-15-8-3-1-2-4-17(8)10(7)19/h1-5H,6H2,(H,16,18) |
| InChIKey | GLUZAIYTMUXYEC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|