About 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide
1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 81340538) has the molecular formula C8H13N3O4S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide |
| PubChem CID | 81340538 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | CC(C)Cn1cc(S(N)(=O)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O4S/c1-5(2)3-11-4-6(16(9,14)15)7(12)10-8(11)13/h4-5H,3H2,1-2H3,(H2,9,14,15)(H,10,12,13) |
| InChIKey | HYFWYEYDSBSZMN-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide?
The IUPAC name of 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide (CID 81340538) is 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide.
What is the SMILES notation for 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide?
The canonical SMILES for 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide is CC(C)Cn1cc(S(N)(=O)=O)c(=O)[nH]c1=O.
What is the InChIKey of 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide?
The InChIKey is HYFWYEYDSBSZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O4S/c1-5(2)3-11-4-6(16(9,14)15)7(12)10-8(11)13/h4-5H,3H2,1-2H3,(H2,9,14,15)(H,10,12,13).
What are the key properties of 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide?
1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide has a molecular weight of 247.28 g/mol, XLogP of -1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-2,4-dioxopyrimidine-5-sulfonamide is sourced from PubChem (CID 81340538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).