C8H9F3N2O3S — CID 81340634
2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81340634) has the molecular formula C8H9F3N2O3S and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 81340634 |
| Molecular Formula | C8H9F3N2O3S |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O3S/c1-5-3-17-7(15)13(5)2-6(14)12-16-4-8(9,10)11/h3H,2,4H2,1H3,(H,12,14) |
| InChIKey | NZILOWDWMYBGHA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|