C10H12F3NO2S — CID 81340698
4-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)butanamide (PubChem CID 81340698) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)butanamide.
| Compound Name | 4-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)butanamide |
|---|---|
| PubChem CID | 81340698 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)butanamide |
| SMILES | O=C(CCCc1cccs1)NOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2S/c11-10(12,13)7-16-14-9(15)5-1-3-8-4-2-6-17-8/h2,4,6H,1,3,5,7H2,(H,14,15) |
| InChIKey | WKOXHUHVLIXEFU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|