C9H6F6N2O3 — CID 81341001
2-oxo-N-(2,2,2-trifluoroethoxy)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 81341001) has the molecular formula C9H6F6N2O3 and a molecular weight of 304.15 g/mol. Its IUPAC name is 2-oxo-N-(2,2,2-trifluoroethoxy)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-(2,2,2-trifluoroethoxy)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81341001 |
| Molecular Formula | C9H6F6N2O3 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-oxo-N-(2,2,2-trifluoroethoxy)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NOCC(F)(F)F)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H6F6N2O3/c10-8(11,12)3-20-17-7(19)4-1-2-5(9(13,14)15)16-6(4)18/h1-2H,3H2,(H,16,18)(H,17,19) |
| InChIKey | HDOIJMBMLMILOL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|