C9H11F3N2O4 — CID 81341058
3-(2,5-dioxopyrrolidin-1-yl)-N-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 81341058) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 81341058 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCN1C(=O)CCC1=O)NOCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O4/c10-9(11,12)5-18-13-6(15)3-4-14-7(16)1-2-8(14)17/h1-5H2,(H,13,15) |
| InChIKey | NINZECQVJJFQKS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|