C8H12F3N3O3S — CID 81341122
1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide (PubChem CID 81341122) has the molecular formula C8H12F3N3O3S and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 81341122 |
| Molecular Formula | C8H12F3N3O3S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(CCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H12F3N3O3S/c9-8(10,11)5-17-3-1-2-14-4-7(13-6-14)18(12,15)16/h4,6H,1-3,5H2,(H2,12,15,16) |
| InChIKey | FVSHZRNPWIAUEC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|