C11H9F3N2O2S2 — CID 81341188
4-methyl-2-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide (PubChem CID 81341188) has the molecular formula C11H9F3N2O2S2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-methyl-2-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 81341188 |
| Molecular Formula | C11H9F3N2O2S2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-methyl-2-thiophen-2-yl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O2S2/c1-6-8(9(17)16-18-5-11(12,13)14)20-10(15-6)7-3-2-4-19-7/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | OBVVBGTVPNABEN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|