About 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione
5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione (PubChem CID 81341192) has the molecular formula C13H11BrO4
and a molecular weight of 311.13 g/mol. Its IUPAC name is 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione |
| PubChem CID | 81341192 |
| Molecular Formula | C13H11BrO4 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)CC(c2cc(Br)c3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H11BrO4/c14-11-3-8(4-12-13(11)18-6-17-12)7-1-9(15)5-10(16)2-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | JNDRBBQIGVLFGQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione?
The IUPAC name of 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione (CID 81341192) is 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione.
What is the SMILES notation for 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione?
The canonical SMILES for 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione is O=C1CC(=O)CC(c2cc(Br)c3c(c2)OCO3)C1.
What is the InChIKey of 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione?
The InChIKey is JNDRBBQIGVLFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO4/c14-11-3-8(4-12-13(11)18-6-17-12)7-1-9(15)5-10(16)2-7/h3-4,7H,1-2,5-6H2.
What are the key properties of 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione?
5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione has a molecular weight of 311.13 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-bromo-1,3-benzodioxol-5-yl)cyclohexane-1,3-dione is sourced from PubChem (CID 81341192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).