C13H16N4O2 — CID 81342274
4-amino-3-(2,5-dimethylpyrazol-3-yl)oxy-N-methylbenzamide (PubChem CID 81342274) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-amino-3-(2,5-dimethylpyrazol-3-yl)oxy-N-methylbenzamide.
| Compound Name | 4-amino-3-(2,5-dimethylpyrazol-3-yl)oxy-N-methylbenzamide |
|---|---|
| PubChem CID | 81342274 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-amino-3-(2,5-dimethylpyrazol-3-yl)oxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)c(Oc2cc(C)nn2C)c1 |
| InChI | InChI=1S/C13H16N4O2/c1-8-6-12(17(3)16-8)19-11-7-9(13(18)15-2)4-5-10(11)14/h4-7H,14H2,1-3H3,(H,15,18) |
| InChIKey | WZLPBQMXQJTGPW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|