C11H21N3O3S — CID 81342657
1-(2-butoxyethyl)-2-ethylimidazole-4-sulfonamide (PubChem CID 81342657) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-2-ethylimidazole-4-sulfonamide.
| Compound Name | 1-(2-butoxyethyl)-2-ethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 81342657 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(2-butoxyethyl)-2-ethylimidazole-4-sulfonamide |
| SMILES | CCCCOCCn1cc(S(N)(=O)=O)nc1CC |
| InChI | InChI=1S/C11H21N3O3S/c1-3-5-7-17-8-6-14-9-11(18(12,15)16)13-10(14)4-2/h9H,3-8H2,1-2H3,(H2,12,15,16) |
| InChIKey | NNOTURHPBWODEF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|