C12H16F3NS2 — CID 81343289
(6S)-6-methyl-N-(4,4,4-trifluorobutyl)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 81343289) has the molecular formula C12H16F3NS2 and a molecular weight of 295.40 g/mol. Its IUPAC name is (6S)-6-methyl-N-(4,4,4-trifluorobutyl)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
| Compound Name | (6S)-6-methyl-N-(4,4,4-trifluorobutyl)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
|---|---|
| PubChem CID | 81343289 |
| Molecular Formula | C12H16F3NS2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (6S)-6-methyl-N-(4,4,4-trifluorobutyl)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | C[C@H]1CC(NCCCC(F)(F)F)c2ccsc2S1 |
| InChI | InChI=1S/C12H16F3NS2/c1-8-7-10(9-3-6-17-11(9)18-8)16-5-2-4-12(13,14)15/h3,6,8,10,16H,2,4-5,7H2,1H3/t8-,10?/m0/s1 |
| InChIKey | PFRYQBMODCOCIG-PEHGTWAWSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|