C12H22F3NO — CID 81343295
2,2,5,5-tetramethyl-N-(4,4,4-trifluorobutyl)oxolan-3-amine (PubChem CID 81343295) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(4,4,4-trifluorobutyl)oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-(4,4,4-trifluorobutyl)oxolan-3-amine |
|---|---|
| PubChem CID | 81343295 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(4,4,4-trifluorobutyl)oxolan-3-amine |
| SMILES | CC1(C)CC(NCCCC(F)(F)F)C(C)(C)O1 |
| InChI | InChI=1S/C12H22F3NO/c1-10(2)8-9(11(3,4)17-10)16-7-5-6-12(13,14)15/h9,16H,5-8H2,1-4H3 |
| InChIKey | UYRQSHODJOIWIT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|