C13H15ClF3N — CID 81343472
5-chloro-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 81343472) has the molecular formula C13H15ClF3N and a molecular weight of 277.72 g/mol. Its IUPAC name is 5-chloro-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 81343472 |
| Molecular Formula | C13H15ClF3N |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-chloro-N-(4,4,4-trifluorobutyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | FC(F)(F)CCCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C13H15ClF3N/c14-11-3-2-9-7-12(8-10(9)6-11)18-5-1-4-13(15,16)17/h2-3,6,12,18H,1,4-5,7-8H2 |
| InChIKey | RETJPBQKXALKIC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|