About 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide
2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81343511) has the molecular formula C6H7F3N4O2
and a molecular weight of 224.14 g/mol. Its IUPAC name is 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide.
Molecular Properties
| Compound Name | 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
| PubChem CID | 81343511 |
| Molecular Formula | C6H7F3N4O2 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(Cn1ccnn1)NOCC(F)(F)F |
| InChI | InChI=1S/C6H7F3N4O2/c7-6(8,9)4-15-11-5(14)3-13-2-1-10-12-13/h1-2H,3-4H2,(H,11,14) |
| InChIKey | AFSWPRSPAIQJJS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide?
The IUPAC name of 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide (CID 81343511) is 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide.
What is the SMILES notation for 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide?
The canonical SMILES for 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide is O=C(Cn1ccnn1)NOCC(F)(F)F.
What is the InChIKey of 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide?
The InChIKey is AFSWPRSPAIQJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N4O2/c7-6(8,9)4-15-11-5(14)3-13-2-1-10-12-13/h1-2H,3-4H2,(H,11,14).
What are the key properties of 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide?
2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide has a molecular weight of 224.14 g/mol, XLogP of -0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)-N-(2,2,2-trifluoroethoxy)acetamide is sourced from PubChem (CID 81343511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).