C12H15N3O4S — CID 81343533
2-[4-methyl-1-(1-methyl-2,6-dioxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81343533) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-[4-methyl-1-(1-methyl-2,6-dioxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-methyl-1-(1-methyl-2,6-dioxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81343533 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[4-methyl-1-(1-methyl-2,6-dioxopiperidin-3-yl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cn(C2CCC(=O)N(C)C2=O)c(SCC(=O)O)n1 |
| InChI | InChI=1S/C12H15N3O4S/c1-7-5-15(12(13-7)20-6-10(17)18)8-3-4-9(16)14(2)11(8)19/h5,8H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | XAYMPUXHUZMJOL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|