C13H17F3N2O — CID 81343566
5-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 81343566) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 81343566 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([nH]1)CCCC2NCCCC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)7-2-8-17-10-3-1-4-11-9(10)5-6-12(19)18-11/h5-6,10,17H,1-4,7-8H2,(H,18,19) |
| InChIKey | RCQGCAVBDFIXMV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|