About 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide
6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide (PubChem CID 81343597) has the molecular formula C10H12F3N3O3
and a molecular weight of 279.22 g/mol. Its IUPAC name is 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide |
| PubChem CID | 81343597 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)NOCC(F)(F)F)ccc1=O |
| InChI | InChI=1S/C10H12F3N3O3/c1-2-5-16-8(17)4-3-7(14-16)9(18)15-19-6-10(11,12)13/h3-4H,2,5-6H2,1H3,(H,15,18) |
| InChIKey | SFCCJFDJUQKSPF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide?
The IUPAC name of 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide (CID 81343597) is 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide.
What is the SMILES notation for 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide?
The canonical SMILES for 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide is CCCn1nc(C(=O)NOCC(F)(F)F)ccc1=O.
What is the InChIKey of 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide?
The InChIKey is SFCCJFDJUQKSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3N3O3/c1-2-5-16-8(17)4-3-7(14-16)9(18)15-19-6-10(11,12)13/h3-4H,2,5-6H2,1H3,(H,15,18).
What are the key properties of 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide?
6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide has a molecular weight of 279.22 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-1-propyl-N-(2,2,2-trifluoroethoxy)pyridazine-3-carboxamide is sourced from PubChem (CID 81343597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).