C14H20F3NS — CID 81343644
4,4,4-trifluoro-N-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]butan-1-amine (PubChem CID 81343644) has the molecular formula C14H20F3NS and a molecular weight of 291.38 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 81343644 |
| Molecular Formula | C14H20F3NS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]butan-1-amine |
| SMILES | CC(NCCCC(F)(F)F)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H20F3NS/c1-10(18-8-4-7-14(15,16)17)13-9-11-5-2-3-6-12(11)19-13/h9-10,18H,2-8H2,1H3 |
| InChIKey | SVAMJGBAQDGRCX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|