C9H11F3N4O2S — CID 81343774
2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81343774) has the molecular formula C9H11F3N4O2S and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 81343774 |
| Molecular Formula | C9H11F3N4O2S |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(CSc1nncn1C1CC1)NOCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N4O2S/c10-9(11,12)4-18-15-7(17)3-19-8-14-13-5-16(8)6-1-2-6/h5-6H,1-4H2,(H,15,17) |
| InChIKey | KQZLNTDMZWQZLW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|