C11H16F3NO — CID 81344002
4,4,4-trifluoro-N-[1-(5-methylfuran-2-yl)ethyl]butan-1-amine (PubChem CID 81344002) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(5-methylfuran-2-yl)ethyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[1-(5-methylfuran-2-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 81344002 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(5-methylfuran-2-yl)ethyl]butan-1-amine |
| SMILES | Cc1ccc(C(C)NCCCC(F)(F)F)o1 |
| InChI | InChI=1S/C11H16F3NO/c1-8-4-5-10(16-8)9(2)15-7-3-6-11(12,13)14/h4-5,9,15H,3,6-7H2,1-2H3 |
| InChIKey | YSUHHQYQCKACTI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|