C17H22N2 — CID 81344166
(1S)-N-[1-(2,5-dimethylphenyl)ethyl]-1-pyridin-3-ylethanamine (PubChem CID 81344166) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (1S)-N-[1-(2,5-dimethylphenyl)ethyl]-1-pyridin-3-ylethanamine.
| Compound Name | (1S)-N-[1-(2,5-dimethylphenyl)ethyl]-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 81344166 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (1S)-N-[1-(2,5-dimethylphenyl)ethyl]-1-pyridin-3-ylethanamine |
| SMILES | Cc1ccc(C)c(C(C)N[C@@H](C)c2cccnc2)c1 |
| InChI | InChI=1S/C17H22N2/c1-12-7-8-13(2)17(10-12)15(4)19-14(3)16-6-5-9-18-11-16/h5-11,14-15,19H,1-4H3/t14-,15?/m0/s1 |
| InChIKey | SWOUVXAGQDCVGR-MLCCFXAWSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |