C11H12BrNO3 — CID 81344910
(4-bromo-2-methoxyphenyl)-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 81344910) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is (4-bromo-2-methoxyphenyl)-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | (4-bromo-2-methoxyphenyl)-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 81344910 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (4-bromo-2-methoxyphenyl)-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | COc1cc(Br)ccc1C(=O)N1CC(O)C1 |
| InChI | InChI=1S/C11H12BrNO3/c1-16-10-4-7(12)2-3-9(10)11(15)13-5-8(14)6-13/h2-4,8,14H,5-6H2,1H3 |
| InChIKey | BZSJVAFWULYEJI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |