C14H20N4O2S — CID 81345227
2-[5-ethyl-1-(4-imidazol-1-ylbutyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81345227) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-[5-ethyl-1-(4-imidazol-1-ylbutyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-ethyl-1-(4-imidazol-1-ylbutyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81345227 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[5-ethyl-1-(4-imidazol-1-ylbutyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CCc1cnc(SCC(=O)O)n1CCCCn1ccnc1 |
| InChI | InChI=1S/C14H20N4O2S/c1-2-12-9-16-14(21-10-13(19)20)18(12)7-4-3-6-17-8-5-15-11-17/h5,8-9,11H,2-4,6-7,10H2,1H3,(H,19,20) |
| InChIKey | MNOQZALAAZXGGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|