About [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine
[4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 81345794) has the molecular formula C9H11FN6O
and a molecular weight of 238.23 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine |
| PubChem CID | 81345794 |
| Molecular Formula | C9H11FN6O |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(Oc2nc(NN)ncc2F)n(C)n1 |
| InChI | InChI=1S/C9H11FN6O/c1-5-3-7(16(2)15-5)17-8-6(10)4-12-9(13-8)14-11/h3-4H,11H2,1-2H3,(H,12,13,14) |
| InChIKey | QAAPOCHDZHZSTG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine?
The IUPAC name of [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine (CID 81345794) is [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine.
What is the SMILES notation for [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine?
The canonical SMILES for [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine is Cc1cc(Oc2nc(NN)ncc2F)n(C)n1.
What is the InChIKey of [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine?
The InChIKey is QAAPOCHDZHZSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN6O/c1-5-3-7(16(2)15-5)17-8-6(10)4-12-9(13-8)14-11/h3-4H,11H2,1-2H3,(H,12,13,14).
What are the key properties of [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine?
[4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine has a molecular weight of 238.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dimethylpyrazol-3-yl)oxy-5-fluoropyrimidin-2-yl]hydrazine is sourced from PubChem (CID 81345794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).