About [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine
[2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine (PubChem CID 81346323) has the molecular formula C11H15N3O2
and a molecular weight of 221.26 g/mol. Its IUPAC name is [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine |
| PubChem CID | 81346323 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine |
| SMILES | Cc1cc(OCc2occc2CN)n(C)n1 |
| InChI | InChI=1S/C11H15N3O2/c1-8-5-11(14(2)13-8)16-7-10-9(6-12)3-4-15-10/h3-5H,6-7,12H2,1-2H3 |
| InChIKey | DIXWHULERRBBGK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine?
The IUPAC name of [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine (CID 81346323) is [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine.
What is the SMILES notation for [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine?
The canonical SMILES for [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine is Cc1cc(OCc2occc2CN)n(C)n1.
What is the InChIKey of [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine?
The InChIKey is DIXWHULERRBBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2/c1-8-5-11(14(2)13-8)16-7-10-9(6-12)3-4-15-10/h3-5H,6-7,12H2,1-2H3.
What are the key properties of [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine?
[2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine has a molecular weight of 221.26 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,5-dimethylpyrazol-3-yl)oxymethyl]furan-3-yl]methanamine is sourced from PubChem (CID 81346323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).