About N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine
N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine (PubChem CID 81346395) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine |
| PubChem CID | 81346395 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine |
| SMILES | Cc1cc(OCCCCCNC(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C14H27N3O/c1-12-11-13(17(5)16-12)18-10-8-6-7-9-15-14(2,3)4/h11,15H,6-10H2,1-5H3 |
| InChIKey | UBZLTSROAPFQRI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine?
The IUPAC name of N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine (CID 81346395) is N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine.
What is the SMILES notation for N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine?
The canonical SMILES for N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine is Cc1cc(OCCCCCNC(C)(C)C)n(C)n1.
What is the InChIKey of N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine?
The InChIKey is UBZLTSROAPFQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-12-11-13(17(5)16-12)18-10-8-6-7-9-15-14(2,3)4/h11,15H,6-10H2,1-5H3.
What are the key properties of N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine?
N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine has a molecular weight of 253.39 g/mol, XLogP of 2.67, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5-(2,5-dimethylpyrazol-3-yl)oxypentan-1-amine is sourced from PubChem (CID 81346395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).