About 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid
4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 81346491) has the molecular formula C11H5Cl2FN2O3
and a molecular weight of 303.08 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid |
| PubChem CID | 81346491 |
| Molecular Formula | C11H5Cl2FN2O3 |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)c(Cl)cc2Cl)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H5Cl2FN2O3/c12-5-2-6(13)7(14)1-4(5)8-3-9(10(17)18)16-11(19)15-8/h1-3H,(H,17,18)(H,15,16,19) |
| InChIKey | ZSLNVMZOKMKMQM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The IUPAC name of 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid (CID 81346491) is 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid.
What is the SMILES notation for 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The canonical SMILES for 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid is O=C(O)c1cc(-c2cc(F)c(Cl)cc2Cl)nc(=O)[nH]1.
What is the InChIKey of 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
The InChIKey is ZSLNVMZOKMKMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2FN2O3/c12-5-2-6(13)7(14)1-4(5)8-3-9(10(17)18)16-11(19)15-8/h1-3H,(H,17,18)(H,15,16,19).
What are the key properties of 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid?
4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid has a molecular weight of 303.08 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichloro-5-fluorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid is sourced from PubChem (CID 81346491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).