C14H18FN3O — CID 81347331
1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 81347331) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 81347331 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | C[C@@H](NCC(O)Cn1cccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3O/c1-11(12-3-5-13(15)6-4-12)16-9-14(19)10-18-8-2-7-17-18/h2-8,11,14,16,19H,9-10H2,1H3/t11-,14?/m1/s1 |
| InChIKey | NRLKYGRIBGPQJZ-YNODCEANSA-N |
| XLogP | 1.73 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |