C15H21FN2O — CID 81347710
2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-piperidin-1-ylethanone (PubChem CID 81347710) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 81347710 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-1-piperidin-1-ylethanone |
| SMILES | C[C@H](NCC(=O)N1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O/c1-12(13-5-7-14(16)8-6-13)17-11-15(19)18-9-3-2-4-10-18/h5-8,12,17H,2-4,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | AYZPFXYRLGTJKL-LBPRGKRZSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |