C18H27N3 — CID 81349612
(1S)-1-(4-methylphenyl)-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]ethanamine (PubChem CID 81349612) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (1S)-1-(4-methylphenyl)-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(4-methylphenyl)-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81349612 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (1S)-1-(4-methylphenyl)-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CCC(CC)n1ccc(CN[C@@H](C)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C18H27N3/c1-5-18(6-2)21-12-11-17(20-21)13-19-15(4)16-9-7-14(3)8-10-16/h7-12,15,18-19H,5-6,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | MWBLBGAQAIAHID-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |