C15H23N — CID 81350463
3,3-dimethyl-N-[(1R)-1-phenylethyl]cyclopentan-1-amine (PubChem CID 81350463) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(1R)-1-phenylethyl]cyclopentan-1-amine.
| Compound Name | 3,3-dimethyl-N-[(1R)-1-phenylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 81350463 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3,3-dimethyl-N-[(1R)-1-phenylethyl]cyclopentan-1-amine |
| SMILES | C[C@@H](NC1CCC(C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C15H23N/c1-12(13-7-5-4-6-8-13)16-14-9-10-15(2,3)11-14/h4-8,12,14,16H,9-11H2,1-3H3/t12-,14?/m1/s1 |
| InChIKey | CXYSSSPZZUMZSY-PUODRLBUSA-N |
| XLogP | 3.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |