C15H14ClF2N — CID 81350945
(1R)-N-[(3-chloro-4-fluorophenyl)methyl]-1-(4-fluorophenyl)ethanamine (PubChem CID 81350945) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is (1R)-N-[(3-chloro-4-fluorophenyl)methyl]-1-(4-fluorophenyl)ethanamine.
| Compound Name | (1R)-N-[(3-chloro-4-fluorophenyl)methyl]-1-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 81350945 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (1R)-N-[(3-chloro-4-fluorophenyl)methyl]-1-(4-fluorophenyl)ethanamine |
| SMILES | C[C@@H](NCc1ccc(F)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14ClF2N/c1-10(12-3-5-13(17)6-4-12)19-9-11-2-7-15(18)14(16)8-11/h2-8,10,19H,9H2,1H3/t10-/m1/s1 |
| InChIKey | BYLZOJZLDRPVRJ-SNVBAGLBSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |