C13H15Br — CID 81351640
2'-(bromomethyl)spiro[2,3-dihydro-1H-naphthalene-4,1'-cyclopropane] (PubChem CID 81351640) has the molecular formula C13H15Br and a molecular weight of 251.17 g/mol. Its IUPAC name is 2'-(bromomethyl)spiro[2,3-dihydro-1H-naphthalene-4,1'-cyclopropane].
| Compound Name | 2'-(bromomethyl)spiro[2,3-dihydro-1H-naphthalene-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 81351640 |
| Molecular Formula | C13H15Br |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2'-(bromomethyl)spiro[2,3-dihydro-1H-naphthalene-4,1'-cyclopropane] |
| SMILES | BrCC1CC12CCCc1ccccc12 |
| InChI | InChI=1S/C13H15Br/c14-9-11-8-13(11)7-3-5-10-4-1-2-6-12(10)13/h1-2,4,6,11H,3,5,7-9H2 |
| InChIKey | FPQIPISNZHAERE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|