C14H21ClN2O — CID 81355233
6-amino-N-[(1S)-1-(4-chlorophenyl)ethyl]hexanamide (PubChem CID 81355233) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 6-amino-N-[(1S)-1-(4-chlorophenyl)ethyl]hexanamide.
| Compound Name | 6-amino-N-[(1S)-1-(4-chlorophenyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 81355233 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6-amino-N-[(1S)-1-(4-chlorophenyl)ethyl]hexanamide |
| SMILES | C[C@H](NC(=O)CCCCCN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O/c1-11(12-6-8-13(15)9-7-12)17-14(18)5-3-2-4-10-16/h6-9,11H,2-5,10,16H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | GCJVULUNQVHOAD-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|