C12H13NO4 — CID 81358141
2-(3-hydroxybutyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 81358141) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(3-hydroxybutyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3-hydroxybutyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 81358141 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(3-hydroxybutyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CC(O)CCc1nc2ccc(C(=O)O)cc2o1 |
| InChI | InChI=1S/C12H13NO4/c1-7(14)2-5-11-13-9-4-3-8(12(15)16)6-10(9)17-11/h3-4,6-7,14H,2,5H2,1H3,(H,15,16) |
| InChIKey | DUHIAKIYKBTHSL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |