2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid

C11H19FO2 — CID 81358386

IUPAC2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid
SMILESCC1(C)CCCC(C(F)C(=O)O)CC1
InChIInChI=1S/C11H19FO2/c1-11(2)6-3-4-8(5-7-11)9(12)10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14)
InChIKeyKYECKIQHRPUYML-UHFFFAOYSA-N
MW202.27 g/mol
LogP3.02
Rot. Bonds2

About 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid

2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid (PubChem CID 81358386) has the molecular formula C11H19FO2 and a molecular weight of 202.27 g/mol. Its IUPAC name is 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid.

Molecular Properties

Compound Name2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid
PubChem CID81358386
Molecular FormulaC11H19FO2
Molecular Weight202.27 g/mol
Exact Mass202.14
IUPAC Name2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid
SMILESCC1(C)CCCC(C(F)C(=O)O)CC1
InChIInChI=1S/C11H19FO2/c1-11(2)6-3-4-8(5-7-11)9(12)10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14)
InChIKeyKYECKIQHRPUYML-UHFFFAOYSA-N
XLogP3.02
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.27
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-fluoro-2-(4-methylcycloheptyl)acetic acid
CID 81358281
2-(4,4-dimethylcyclohexyl)-2-hydroxyacetic acid
CID 66287773
2-(4-ethylcyclohexyl)-2-fluoroacetic acid
CID 81358265
2-fluoro-2-(3-methoxycyclohexyl)acetic acid
CID 106873222
1-(4,4-dimethylcycloheptyl)-2-methylpropan-1-amine
CID 79299029
2-(4,4-dimethylcyclohexyl)-2-formamidoacetic acid
CID 130596189
2-(1-ethylpiperidin-3-yl)-2-fluoroacetic acid
CID 105443609
methyl (2S)-2-[(4,4-dimethylcycloheptyl)amino]propanoate
CID 65084501
1,1-dimethyl-4-propan-2-ylcyclohexane;propan-2-ylcyclohexane
CID 165006340
2-fluoro-2-(1-hydroxy-3,3-dimethylcyclohexyl)acetic acid
CID 79366352
3-[(4,4-dimethylcycloheptyl)amino]propanoic acid
CID 65084019
2-(3-aminocyclobutyl)-2-fluoroacetic acid
CID 146155614

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid?
The IUPAC name of 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid (CID 81358386) is 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid.
What is the SMILES notation for 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid?
The canonical SMILES for 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid is CC1(C)CCCC(C(F)C(=O)O)CC1.
What is the InChIKey of 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid?
The InChIKey is KYECKIQHRPUYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO2/c1-11(2)6-3-4-8(5-7-11)9(12)10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14).
What are the key properties of 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid?
2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid has a molecular weight of 202.27 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcycloheptyl)-2-fluoroacetic acid is sourced from PubChem (CID 81358386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).