About 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid
2-fluoro-5-methoxy-3,5-dimethylhexanoic acid (PubChem CID 81358923) has the molecular formula C9H17FO3
and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid |
| PubChem CID | 81358923 |
| Molecular Formula | C9H17FO3 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid |
| SMILES | COC(C)(C)CC(C)C(F)C(=O)O |
| InChI | InChI=1S/C9H17FO3/c1-6(7(10)8(11)12)5-9(2,3)13-4/h6-7H,5H2,1-4H3,(H,11,12) |
| InChIKey | XGHXIJOHDAPKMP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid?
The IUPAC name of 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid (CID 81358923) is 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid.
What is the SMILES notation for 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid?
The canonical SMILES for 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid is COC(C)(C)CC(C)C(F)C(=O)O.
What is the InChIKey of 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid?
The InChIKey is XGHXIJOHDAPKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FO3/c1-6(7(10)8(11)12)5-9(2,3)13-4/h6-7H,5H2,1-4H3,(H,11,12).
What are the key properties of 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid?
2-fluoro-5-methoxy-3,5-dimethylhexanoic acid has a molecular weight of 192.23 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-methoxy-3,5-dimethylhexanoic acid is sourced from PubChem (CID 81358923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).