C14H23NO — CID 81360459
3-ethoxy-N-[(1S)-1-(3-methylphenyl)ethyl]propan-1-amine (PubChem CID 81360459) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-ethoxy-N-[(1S)-1-(3-methylphenyl)ethyl]propan-1-amine.
| Compound Name | 3-ethoxy-N-[(1S)-1-(3-methylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81360459 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-ethoxy-N-[(1S)-1-(3-methylphenyl)ethyl]propan-1-amine |
| SMILES | CCOCCCN[C@@H](C)c1cccc(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-4-16-10-6-9-15-13(3)14-8-5-7-12(2)11-14/h5,7-8,11,13,15H,4,6,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | KBZJIYNCGHTXOT-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|