C10H14N2O3S — CID 81361593
1-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 81361593) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81361593 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[[[2-(cyanomethylsulfanyl)acetyl]amino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | N#CCSCC(=O)NCC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C10H14N2O3S/c11-4-5-16-6-8(13)12-7-10(9(14)15)2-1-3-10/h1-3,5-7H2,(H,12,13)(H,14,15) |
| InChIKey | CASYNXREHAAFOM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|