(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid

C8H10N2O4 — CID 81361666

IUPAC(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid
SMILESCc1ncoc1C(=O)N[C@@H](C)C(=O)O
InChIInChI=1S/C8H10N2O4/c1-4-6(14-3-9-4)7(11)10-5(2)8(12)13/h3,5H,1-2H3,(H,10,11)(H,12,13)/t5-/m0/s1
InChIKeyZKHQAEHWGTZSQV-YFKPBYRVSA-N
MW198.18 g/mol
LogP0.19
Rot. Bonds3

About (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid

(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid (PubChem CID 81361666) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid.

Molecular Properties

Compound Name(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid
PubChem CID81361666
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid
SMILESCc1ncoc1C(=O)N[C@@H](C)C(=O)O
InChIInChI=1S/C8H10N2O4/c1-4-6(14-3-9-4)7(11)10-5(2)8(12)13/h3,5H,1-2H3,(H,10,11)(H,12,13)/t5-/m0/s1
InChIKeyZKHQAEHWGTZSQV-YFKPBYRVSA-N
XLogP0.19
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 50.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid?
The IUPAC name of (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid (CID 81361666) is (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid.
What is the SMILES notation for (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid?
The canonical SMILES for (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid is Cc1ncoc1C(=O)N[C@@H](C)C(=O)O.
What is the InChIKey of (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid?
The InChIKey is ZKHQAEHWGTZSQV-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-4-6(14-3-9-4)7(11)10-5(2)8(12)13/h3,5H,1-2H3,(H,10,11)(H,12,13)/t5-/m0/s1.
What are the key properties of (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid?
(2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid has a molecular weight of 198.18 g/mol, XLogP of 0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-methyl-1,3-oxazole-5-carbonyl)amino]propanoic acid is sourced from PubChem (CID 81361666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).