C16H24FN — CID 81364942
2-ethyl-N-[(1S)-1-(3-fluorophenyl)ethyl]cyclohexan-1-amine (PubChem CID 81364942) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 2-ethyl-N-[(1S)-1-(3-fluorophenyl)ethyl]cyclohexan-1-amine.
| Compound Name | 2-ethyl-N-[(1S)-1-(3-fluorophenyl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 81364942 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 2-ethyl-N-[(1S)-1-(3-fluorophenyl)ethyl]cyclohexan-1-amine |
| SMILES | CCC1CCCCC1N[C@@H](C)c1cccc(F)c1 |
| InChI | InChI=1S/C16H24FN/c1-3-13-7-4-5-10-16(13)18-12(2)14-8-6-9-15(17)11-14/h6,8-9,11-13,16,18H,3-5,7,10H2,1-2H3/t12-,13?,16?/m0/s1 |
| InChIKey | DXVLFMKHWOEZIF-FUJMWEONSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |