C15H24FNO2 — CID 81365209
3,3-diethoxy-N-[(1S)-1-(3-fluorophenyl)ethyl]propan-1-amine (PubChem CID 81365209) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 3,3-diethoxy-N-[(1S)-1-(3-fluorophenyl)ethyl]propan-1-amine.
| Compound Name | 3,3-diethoxy-N-[(1S)-1-(3-fluorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81365209 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3,3-diethoxy-N-[(1S)-1-(3-fluorophenyl)ethyl]propan-1-amine |
| SMILES | CCOC(CCN[C@@H](C)c1cccc(F)c1)OCC |
| InChI | InChI=1S/C15H24FNO2/c1-4-18-15(19-5-2)9-10-17-12(3)13-7-6-8-14(16)11-13/h6-8,11-12,15,17H,4-5,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VEJUVHYZOPUGPJ-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|