C13H16ClN3 — CID 81366906
(1S)-1-(3-chlorophenyl)-N-[1-(1H-pyrazol-5-yl)ethyl]ethanamine (PubChem CID 81366906) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is (1S)-1-(3-chlorophenyl)-N-[1-(1H-pyrazol-5-yl)ethyl]ethanamine.
| Compound Name | (1S)-1-(3-chlorophenyl)-N-[1-(1H-pyrazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81366906 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (1S)-1-(3-chlorophenyl)-N-[1-(1H-pyrazol-5-yl)ethyl]ethanamine |
| SMILES | CC(N[C@@H](C)c1cccc(Cl)c1)c1ccn[nH]1 |
| InChI | InChI=1S/C13H16ClN3/c1-9(11-4-3-5-12(14)8-11)16-10(2)13-6-7-15-17-13/h3-10,16H,1-2H3,(H,15,17)/t9-,10?/m0/s1 |
| InChIKey | WMVBJBPVUWVQIO-RGURZIINSA-N |
| XLogP | 3.47 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |