C15H13ClN2O3 — CID 81368393
3-[4-[(6-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid (PubChem CID 81368393) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-[4-[(6-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[(6-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 81368393 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[4-[(6-chloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C15H13ClN2O3/c16-13-7-4-11(9-17-13)15(21)18-12-5-1-10(2-6-12)3-8-14(19)20/h1-2,4-7,9H,3,8H2,(H,18,21)(H,19,20) |
| InChIKey | XPBJRHFQPMLONT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|